C18H38O4Si — CID 11484799
(3R,5R,6S)-1-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-6-methylnon-8-en-3-ol (PubChem CID 11484799) has the molecular formula C18H38O4Si and a molecular weight of 346.58 g/mol. Its IUPAC name is (3R,5R,6S)-1-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-6-methylnon-8-en-3-ol.
| Compound Name | (3R,5R,6S)-1-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-6-methylnon-8-en-3-ol |
|---|---|
| PubChem CID | 11484799 |
| Molecular Formula | C18H38O4Si |
| Molecular Weight | 346.58 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | (3R,5R,6S)-1-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-6-methylnon-8-en-3-ol |
| SMILES | C=CC[C@H](C)[C@@H](C[C@H](O)CCO[Si](C)(C)C(C)(C)C)OCOC |
| InChI | InChI=1S/C18H38O4Si/c1-9-10-15(2)17(21-14-20-6)13-16(19)11-12-22-23(7,8)18(3,4)5/h9,15-17,19H,1,10-14H2,2-8H3/t15-,16+,17+/m0/s1 |
| InChIKey | VANWYQGKLUAJSY-GVDBMIGSSA-N |
| XLogP | 4.35 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|