C17H29ClN2 — CID 114848070
N-butan-2-yl-5-chloro-N-ethyl-2-[(2-methylpropylamino)methyl]aniline (PubChem CID 114848070) has the molecular formula C17H29ClN2 and a molecular weight of 296.89 g/mol. Its IUPAC name is N-butan-2-yl-5-chloro-N-ethyl-2-[(2-methylpropylamino)methyl]aniline.
| Compound Name | N-butan-2-yl-5-chloro-N-ethyl-2-[(2-methylpropylamino)methyl]aniline |
|---|---|
| PubChem CID | 114848070 |
| Molecular Formula | C17H29ClN2 |
| Molecular Weight | 296.89 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | N-butan-2-yl-5-chloro-N-ethyl-2-[(2-methylpropylamino)methyl]aniline |
| SMILES | CCC(C)N(CC)c1cc(Cl)ccc1CNCC(C)C |
| InChI | InChI=1S/C17H29ClN2/c1-6-14(5)20(7-2)17-10-16(18)9-8-15(17)12-19-11-13(3)4/h8-10,13-14,19H,6-7,11-12H2,1-5H3 |
| InChIKey | QAOZRITZHQUPGN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.89 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |