C22H39NO2 — CID 11484877
(3S)-3-[(2S,4aS,7R,8aR)-4,4,7-trimethyl-3-prop-2-enyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-2-methylhept-6-en-3-ol (PubChem CID 11484877) has the molecular formula C22H39NO2 and a molecular weight of 349.56 g/mol. Its IUPAC name is (3S)-3-[(2S,4aS,7R,8aR)-4,4,7-trimethyl-3-prop-2-enyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-2-methylhept-6-en-3-ol.
| Compound Name | (3S)-3-[(2S,4aS,7R,8aR)-4,4,7-trimethyl-3-prop-2-enyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-2-methylhept-6-en-3-ol |
|---|---|
| PubChem CID | 11484877 |
| Molecular Formula | C22H39NO2 |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.30 |
| IUPAC Name | (3S)-3-[(2S,4aS,7R,8aR)-4,4,7-trimethyl-3-prop-2-enyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-2-methylhept-6-en-3-ol |
| SMILES | C=CCC[C@](O)(C(C)C)[C@@H]1O[C@@H]2C[C@H](C)CC[C@H]2C(C)(C)N1CC=C |
| InChI | InChI=1S/C22H39NO2/c1-8-10-13-22(24,16(3)4)20-23(14-9-2)21(6,7)18-12-11-17(5)15-19(18)25-20/h8-9,16-20,24H,1-2,10-15H2,3-7H3/t17-,18-,19-,20+,22+/m1/s1 |
| InChIKey | RJGSJAHJUOXLOI-YHZBMZHBSA-N |
| XLogP | 4.77 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|