About O-methyl N-[[1-(3,5-difluoro-4-imidazol-1-ylphenyl)triazol-4-yl]methyl]carbamothioate
O-methyl N-[[1-(3,5-difluoro-4-imidazol-1-ylphenyl)triazol-4-yl]methyl]carbamothioate (PubChem CID 11484897) has the molecular formula C14H12F2N6OS
and a molecular weight of 350.35 g/mol. Its IUPAC name is O-methyl N-[[1-(3,5-difluoro-4-imidazol-1-ylphenyl)triazol-4-yl]methyl]carbamothioate.
Molecular Properties
| Compound Name | O-methyl N-[[1-(3,5-difluoro-4-imidazol-1-ylphenyl)triazol-4-yl]methyl]carbamothioate |
| PubChem CID | 11484897 |
| Molecular Formula | C14H12F2N6OS |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | O-methyl N-[[1-(3,5-difluoro-4-imidazol-1-ylphenyl)triazol-4-yl]methyl]carbamothioate |
| SMILES | COC(=S)NCc1cn(-c2cc(F)c(-n3ccnc3)c(F)c2)nn1 |
| InChI | InChI=1S/C14H12F2N6OS/c1-23-14(24)18-6-9-7-22(20-19-9)10-4-11(15)13(12(16)5-10)21-3-2-17-8-21/h2-5,7-8H,6H2,1H3,(H,18,24) |
| InChIKey | WAZMXNBSFWVTJX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-methyl N-[[1-(3,5-difluoro-4-imidazol-1-ylphenyl)triazol-4-yl]methyl]carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-methyl N-[[1-(3,5-difluoro-4-imidazol-1-ylphenyl)triazol-4-yl]methyl]carbamothioate?
The IUPAC name of O-methyl N-[[1-(3,5-difluoro-4-imidazol-1-ylphenyl)triazol-4-yl]methyl]carbamothioate (CID 11484897) is O-methyl N-[[1-(3,5-difluoro-4-imidazol-1-ylphenyl)triazol-4-yl]methyl]carbamothioate.
What is the SMILES notation for O-methyl N-[[1-(3,5-difluoro-4-imidazol-1-ylphenyl)triazol-4-yl]methyl]carbamothioate?
The canonical SMILES for O-methyl N-[[1-(3,5-difluoro-4-imidazol-1-ylphenyl)triazol-4-yl]methyl]carbamothioate is COC(=S)NCc1cn(-c2cc(F)c(-n3ccnc3)c(F)c2)nn1.
What is the InChIKey of O-methyl N-[[1-(3,5-difluoro-4-imidazol-1-ylphenyl)triazol-4-yl]methyl]carbamothioate?
The InChIKey is WAZMXNBSFWVTJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F2N6OS/c1-23-14(24)18-6-9-7-22(20-19-9)10-4-11(15)13(12(16)5-10)21-3-2-17-8-21/h2-5,7-8H,6H2,1H3,(H,18,24).
What are the key properties of O-methyl N-[[1-(3,5-difluoro-4-imidazol-1-ylphenyl)triazol-4-yl]methyl]carbamothioate?
O-methyl N-[[1-(3,5-difluoro-4-imidazol-1-ylphenyl)triazol-4-yl]methyl]carbamothioate has a molecular weight of 350.35 g/mol, XLogP of 1.75, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for O-methyl N-[[1-(3,5-difluoro-4-imidazol-1-ylphenyl)triazol-4-yl]methyl]carbamothioate is sourced from PubChem (CID 11484897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).