C21H25NO4 — CID 11485043
dimethyl (4aR,11cS)-7-methyl-2,3,4,4a,6,11c-hexahydro-1H-benzo[c]carbazole-5,5-dicarboxylate (PubChem CID 11485043) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is dimethyl (4aR,11cS)-7-methyl-2,3,4,4a,6,11c-hexahydro-1H-benzo[c]carbazole-5,5-dicarboxylate.
| Compound Name | dimethyl (4aR,11cS)-7-methyl-2,3,4,4a,6,11c-hexahydro-1H-benzo[c]carbazole-5,5-dicarboxylate |
|---|---|
| PubChem CID | 11485043 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | dimethyl (4aR,11cS)-7-methyl-2,3,4,4a,6,11c-hexahydro-1H-benzo[c]carbazole-5,5-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2c(c3ccccc3n2C)[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C21H25NO4/c1-22-16-11-7-5-9-14(16)18-13-8-4-6-10-15(13)21(12-17(18)22,19(23)25-2)20(24)26-3/h5,7,9,11,13,15H,4,6,8,10,12H2,1-3H3/t13-,15+/m0/s1 |
| InChIKey | BKVITMLKDJMTLV-DZGCQCFKSA-N |
| XLogP | 3.34 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|