C17H25ClN2O — CID 114851448
8-[5-chloro-2-[(propan-2-ylamino)methyl]phenyl]-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 114851448) has the molecular formula C17H25ClN2O and a molecular weight of 308.85 g/mol. Its IUPAC name is 8-[5-chloro-2-[(propan-2-ylamino)methyl]phenyl]-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8-[5-chloro-2-[(propan-2-ylamino)methyl]phenyl]-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 114851448 |
| Molecular Formula | C17H25ClN2O |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 8-[5-chloro-2-[(propan-2-ylamino)methyl]phenyl]-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | CC(C)NCc1ccc(Cl)cc1N1C2CCC1CC(O)C2 |
| InChI | InChI=1S/C17H25ClN2O/c1-11(2)19-10-12-3-4-13(18)7-17(12)20-14-5-6-15(20)9-16(21)8-14/h3-4,7,11,14-16,19,21H,5-6,8-10H2,1-2H3 |
| InChIKey | IFVNUYZVCCZHHB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |