C16H25ClN2 — CID 114851500
4-chloro-N-methyl-N-[(2-methylcyclopropyl)methyl]-2-[(propan-2-ylamino)methyl]aniline (PubChem CID 114851500) has the molecular formula C16H25ClN2 and a molecular weight of 280.84 g/mol. Its IUPAC name is 4-chloro-N-methyl-N-[(2-methylcyclopropyl)methyl]-2-[(propan-2-ylamino)methyl]aniline.
| Compound Name | 4-chloro-N-methyl-N-[(2-methylcyclopropyl)methyl]-2-[(propan-2-ylamino)methyl]aniline |
|---|---|
| PubChem CID | 114851500 |
| Molecular Formula | C16H25ClN2 |
| Molecular Weight | 280.84 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 4-chloro-N-methyl-N-[(2-methylcyclopropyl)methyl]-2-[(propan-2-ylamino)methyl]aniline |
| SMILES | CC(C)NCc1cc(Cl)ccc1N(C)CC1CC1C |
| InChI | InChI=1S/C16H25ClN2/c1-11(2)18-9-13-8-15(17)5-6-16(13)19(4)10-14-7-12(14)3/h5-6,8,11-12,14,18H,7,9-10H2,1-4H3 |
| InChIKey | OONFGLKLOMCGBX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.84 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |