C19H18FNO3S — CID 11485167
(9S)-9-(3-ethenyl-4-fluorophenyl)-1,1-dioxo-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one (PubChem CID 11485167) has the molecular formula C19H18FNO3S and a molecular weight of 359.42 g/mol. Its IUPAC name is (9S)-9-(3-ethenyl-4-fluorophenyl)-1,1-dioxo-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one.
| Compound Name | (9S)-9-(3-ethenyl-4-fluorophenyl)-1,1-dioxo-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one |
|---|---|
| PubChem CID | 11485167 |
| Molecular Formula | C19H18FNO3S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | (9S)-9-(3-ethenyl-4-fluorophenyl)-1,1-dioxo-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one |
| SMILES | C=Cc1cc([C@H]2C3=C(CCCC3=O)NC3=C2S(=O)(=O)CC3)ccc1F |
| InChI | InChI=1S/C19H18FNO3S/c1-2-11-10-12(6-7-13(11)20)17-18-14(4-3-5-16(18)22)21-15-8-9-25(23,24)19(15)17/h2,6-7,10,17,21H,1,3-5,8-9H2/t17-/m0/s1 |
| InChIKey | DYEMLXVPNSWCBS-KRWDZBQOSA-N |
| XLogP | 3.19 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |