C16H24O2 — CID 114851831
5-methoxy-2-(5,6,7,8-tetrahydronaphthalen-2-yl)pentan-2-ol (PubChem CID 114851831) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 5-methoxy-2-(5,6,7,8-tetrahydronaphthalen-2-yl)pentan-2-ol.
| Compound Name | 5-methoxy-2-(5,6,7,8-tetrahydronaphthalen-2-yl)pentan-2-ol |
|---|---|
| PubChem CID | 114851831 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 5-methoxy-2-(5,6,7,8-tetrahydronaphthalen-2-yl)pentan-2-ol |
| SMILES | COCCCC(C)(O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C16H24O2/c1-16(17,10-5-11-18-2)15-9-8-13-6-3-4-7-14(13)12-15/h8-9,12,17H,3-7,10-11H2,1-2H3 |
| InChIKey | VJOZGOYJSMSJRX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|