C14H21ClN2O2S2 — CID 114852258
1-[5-chloro-2-(3-ethylsulfonylthiomorpholin-4-yl)phenyl]-N-methylmethanamine (PubChem CID 114852258) has the molecular formula C14H21ClN2O2S2 and a molecular weight of 348.92 g/mol. Its IUPAC name is 1-[5-chloro-2-(3-ethylsulfonylthiomorpholin-4-yl)phenyl]-N-methylmethanamine.
| Compound Name | 1-[5-chloro-2-(3-ethylsulfonylthiomorpholin-4-yl)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 114852258 |
| Molecular Formula | C14H21ClN2O2S2 |
| Molecular Weight | 348.92 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 1-[5-chloro-2-(3-ethylsulfonylthiomorpholin-4-yl)phenyl]-N-methylmethanamine |
| SMILES | CCS(=O)(=O)C1CSCCN1c1ccc(Cl)cc1CNC |
| InChI | InChI=1S/C14H21ClN2O2S2/c1-3-21(18,19)14-10-20-7-6-17(14)13-5-4-12(15)8-11(13)9-16-2/h4-5,8,14,16H,3,6-7,9-10H2,1-2H3 |
| InChIKey | LOBONSDZHPDEKR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.92 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |