C13H14ClN3 — CID 114854126
N-[(5-chloro-2-imidazol-1-ylphenyl)methyl]cyclopropanamine (PubChem CID 114854126) has the molecular formula C13H14ClN3 and a molecular weight of 247.73 g/mol. Its IUPAC name is N-[(5-chloro-2-imidazol-1-ylphenyl)methyl]cyclopropanamine.
| Compound Name | N-[(5-chloro-2-imidazol-1-ylphenyl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 114854126 |
| Molecular Formula | C13H14ClN3 |
| Molecular Weight | 247.73 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | N-[(5-chloro-2-imidazol-1-ylphenyl)methyl]cyclopropanamine |
| SMILES | Clc1ccc(-n2ccnc2)c(CNC2CC2)c1 |
| InChI | InChI=1S/C13H14ClN3/c14-11-1-4-13(17-6-5-15-9-17)10(7-11)8-16-12-2-3-12/h1,4-7,9,12,16H,2-3,8H2 |
| InChIKey | NMIFTIKBMYVEJV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.73 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |