About 1-(3-ethyl-1,4-dithian-2-yl)-4-methoxybutan-1-one
1-(3-ethyl-1,4-dithian-2-yl)-4-methoxybutan-1-one (PubChem CID 114854228) has the molecular formula C11H20O2S2
and a molecular weight of 248.41 g/mol. Its IUPAC name is 1-(3-ethyl-1,4-dithian-2-yl)-4-methoxybutan-1-one.
Molecular Properties
| Compound Name | 1-(3-ethyl-1,4-dithian-2-yl)-4-methoxybutan-1-one |
| PubChem CID | 114854228 |
| Molecular Formula | C11H20O2S2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 1-(3-ethyl-1,4-dithian-2-yl)-4-methoxybutan-1-one |
| SMILES | CCC1SCCSC1C(=O)CCCOC |
| InChI | InChI=1S/C11H20O2S2/c1-3-10-11(15-8-7-14-10)9(12)5-4-6-13-2/h10-11H,3-8H2,1-2H3 |
| InChIKey | ADZVXGPUXKSMHN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-ethyl-1,4-dithian-2-yl)-4-methoxybutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethyl-1,4-dithian-2-yl)-4-methoxybutan-1-one?
The IUPAC name of 1-(3-ethyl-1,4-dithian-2-yl)-4-methoxybutan-1-one (CID 114854228) is 1-(3-ethyl-1,4-dithian-2-yl)-4-methoxybutan-1-one.
What is the SMILES notation for 1-(3-ethyl-1,4-dithian-2-yl)-4-methoxybutan-1-one?
The canonical SMILES for 1-(3-ethyl-1,4-dithian-2-yl)-4-methoxybutan-1-one is CCC1SCCSC1C(=O)CCCOC.
What is the InChIKey of 1-(3-ethyl-1,4-dithian-2-yl)-4-methoxybutan-1-one?
The InChIKey is ADZVXGPUXKSMHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2S2/c1-3-10-11(15-8-7-14-10)9(12)5-4-6-13-2/h10-11H,3-8H2,1-2H3.
What are the key properties of 1-(3-ethyl-1,4-dithian-2-yl)-4-methoxybutan-1-one?
1-(3-ethyl-1,4-dithian-2-yl)-4-methoxybutan-1-one has a molecular weight of 248.41 g/mol, XLogP of 2.61, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethyl-1,4-dithian-2-yl)-4-methoxybutan-1-one is sourced from PubChem (CID 114854228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).