C15H31NO2 — CID 114857240
1-(1-ethoxy-4,4-dimethylcyclohexyl)-4-methoxybutan-1-amine (PubChem CID 114857240) has the molecular formula C15H31NO2 and a molecular weight of 257.42 g/mol. Its IUPAC name is 1-(1-ethoxy-4,4-dimethylcyclohexyl)-4-methoxybutan-1-amine.
| Compound Name | 1-(1-ethoxy-4,4-dimethylcyclohexyl)-4-methoxybutan-1-amine |
|---|---|
| PubChem CID | 114857240 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | 1-(1-ethoxy-4,4-dimethylcyclohexyl)-4-methoxybutan-1-amine |
| SMILES | CCOC1(C(N)CCCOC)CCC(C)(C)CC1 |
| InChI | InChI=1S/C15H31NO2/c1-5-18-15(13(16)7-6-12-17-4)10-8-14(2,3)9-11-15/h13H,5-12,16H2,1-4H3 |
| InChIKey | YGURKHYHOIHRMG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|