C21H22N4O3 — CID 11485752
N-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]phenyl]benzamide (PubChem CID 11485752) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]phenyl]benzamide.
| Compound Name | N-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 11485752 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]phenyl]benzamide |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(NC(=O)c3ccccc3)cc2)no1 |
| InChI | InChI=1S/C21H22N4O3/c1-21(2,3)17-13-18(25-28-17)24-20(27)23-16-11-9-15(10-12-16)22-19(26)14-7-5-4-6-8-14/h4-13H,1-3H3,(H,22,26)(H2,23,24,25,27) |
| InChIKey | ROTBQIKMDLCWME-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |