C15H20ClN3O — CID 114857831
N-[[4-chloro-2-(1-ethylpyrazol-4-yl)oxyphenyl]methyl]propan-1-amine (PubChem CID 114857831) has the molecular formula C15H20ClN3O and a molecular weight of 293.80 g/mol. Its IUPAC name is N-[[4-chloro-2-(1-ethylpyrazol-4-yl)oxyphenyl]methyl]propan-1-amine.
| Compound Name | N-[[4-chloro-2-(1-ethylpyrazol-4-yl)oxyphenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 114857831 |
| Molecular Formula | C15H20ClN3O |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N-[[4-chloro-2-(1-ethylpyrazol-4-yl)oxyphenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(Cl)cc1Oc1cnn(CC)c1 |
| InChI | InChI=1S/C15H20ClN3O/c1-3-7-17-9-12-5-6-13(16)8-15(12)20-14-10-18-19(4-2)11-14/h5-6,8,10-11,17H,3-4,7,9H2,1-2H3 |
| InChIKey | GBSUBWNVZDGBDQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|