C22H40O3Si — CID 11485817
[(2R,4aR,8aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4a,8,8-trimethyl-1,2,5,6,7,8a-hexahydronaphthalen-2-yl] acetate (PubChem CID 11485817) has the molecular formula C22H40O3Si and a molecular weight of 380.65 g/mol. Its IUPAC name is [(2R,4aR,8aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4a,8,8-trimethyl-1,2,5,6,7,8a-hexahydronaphthalen-2-yl] acetate.
| Compound Name | [(2R,4aR,8aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4a,8,8-trimethyl-1,2,5,6,7,8a-hexahydronaphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 11485817 |
| Molecular Formula | C22H40O3Si |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | [(2R,4aR,8aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4a,8,8-trimethyl-1,2,5,6,7,8a-hexahydronaphthalen-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H]2C(C)(C)CCC[C@]2(C)C=C1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O3Si/c1-16(23)25-18-13-19-21(5,6)11-10-12-22(19,7)14-17(18)15-24-26(8,9)20(2,3)4/h14,18-19H,10-13,15H2,1-9H3/t18-,19+,22-/m1/s1 |
| InChIKey | IGMZZLJWANCKMZ-XQBPLPMBSA-N |
| XLogP | 6.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|