C17H16ClNO2 — CID 114858425
(E)-3-[4-chloro-2-(N,2-dimethylanilino)phenyl]prop-2-enoic acid (PubChem CID 114858425) has the molecular formula C17H16ClNO2 and a molecular weight of 301.77 g/mol. Its IUPAC name is (E)-3-[4-chloro-2-(N,2-dimethylanilino)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-chloro-2-(N,2-dimethylanilino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 114858425 |
| Molecular Formula | C17H16ClNO2 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | (E)-3-[4-chloro-2-(N,2-dimethylanilino)phenyl]prop-2-enoic acid |
| SMILES | Cc1ccccc1N(C)c1cc(Cl)ccc1/C=C/C(=O)O |
| InChI | InChI=1S/C17H16ClNO2/c1-12-5-3-4-6-15(12)19(2)16-11-14(18)9-7-13(16)8-10-17(20)21/h3-11H,1-2H3,(H,20,21)/b10-8+ |
| InChIKey | RIEPEAJJCUATSQ-CSKARUKUSA-N |
| XLogP | 4.51 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|