C19H17N3O4S — CID 11485897
ethyl 5-(1H-indol-3-yl)-7-methyl-4-oxo-2-sulfanylidene-1,5-dihydropyrano[2,3-d]pyrimidine-6-carboxylate (PubChem CID 11485897) has the molecular formula C19H17N3O4S and a molecular weight of 383.43 g/mol. Its IUPAC name is ethyl 5-(1H-indol-3-yl)-7-methyl-4-oxo-2-sulfanylidene-1,5-dihydropyrano[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 5-(1H-indol-3-yl)-7-methyl-4-oxo-2-sulfanylidene-1,5-dihydropyrano[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 11485897 |
| Molecular Formula | C19H17N3O4S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | ethyl 5-(1H-indol-3-yl)-7-methyl-4-oxo-2-sulfanylidene-1,5-dihydropyrano[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Oc2[nH]c(=S)[nH]c(=O)c2C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H17N3O4S/c1-3-25-18(24)13-9(2)26-17-15(16(23)21-19(27)22-17)14(13)11-8-20-12-7-5-4-6-10(11)12/h4-8,14,20H,3H2,1-2H3,(H2,21,22,23,27) |
| InChIKey | DEYPPZOWWGOIOP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 99.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|