C22H31NO3Si — CID 11485967
1-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]-2-methyl-2,7-dihydrofuro[3,4-b]pyridin-5-one (PubChem CID 11485967) has the molecular formula C22H31NO3Si and a molecular weight of 385.58 g/mol. Its IUPAC name is 1-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]-2-methyl-2,7-dihydrofuro[3,4-b]pyridin-5-one.
| Compound Name | 1-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]-2-methyl-2,7-dihydrofuro[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 11485967 |
| Molecular Formula | C22H31NO3Si |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 1-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]-2-methyl-2,7-dihydrofuro[3,4-b]pyridin-5-one |
| SMILES | CC1C=CC2=C(COC2=O)N1[C@@H](CO[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H31NO3Si/c1-16-12-13-18-20(14-25-21(18)24)23(16)19(17-10-8-7-9-11-17)15-26-27(5,6)22(2,3)4/h7-13,16,19H,14-15H2,1-6H3/t16?,19-/m0/s1 |
| InChIKey | BALVNCXGAFXMLP-CVMIBEPCSA-N |
| XLogP | 4.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|