C25H38O3 — CID 11485995
(1S,3E,7E,11S,12E,15R,16S,17S,20R)-11-hydroxy-1,4,8,12,17-pentamethyl-19-oxatricyclo[13.6.0.016,20]henicosa-3,7,12-trien-21-one (PubChem CID 11485995) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is (1S,3E,7E,11S,12E,15R,16S,17S,20R)-11-hydroxy-1,4,8,12,17-pentamethyl-19-oxatricyclo[13.6.0.016,20]henicosa-3,7,12-trien-21-one.
| Compound Name | (1S,3E,7E,11S,12E,15R,16S,17S,20R)-11-hydroxy-1,4,8,12,17-pentamethyl-19-oxatricyclo[13.6.0.016,20]henicosa-3,7,12-trien-21-one |
|---|---|
| PubChem CID | 11485995 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | (1S,3E,7E,11S,12E,15R,16S,17S,20R)-11-hydroxy-1,4,8,12,17-pentamethyl-19-oxatricyclo[13.6.0.016,20]henicosa-3,7,12-trien-21-one |
| SMILES | C/C1=C\C[C@]2(C)C(=O)[C@@H]3OC[C@@H](C)[C@@H]3[C@H]2C/C=C(\C)[C@@H](O)CC/C(C)=C/CC1 |
| InChI | InChI=1S/C25H38O3/c1-16-7-6-8-17(2)13-14-25(5)20(11-10-18(3)21(26)12-9-16)22-19(4)15-28-23(22)24(25)27/h7,10,13,19-23,26H,6,8-9,11-12,14-15H2,1-5H3/b16-7+,17-13+,18-10+/t19-,20-,21+,22-,23-,25+/m1/s1 |
| InChIKey | GKWFKMYDBNVGSS-WWXLREHISA-N |
| XLogP | 5.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|