About 1-[(4-chloro-2-fluorophenyl)methyl]-3,3-diethylpiperazine
1-[(4-chloro-2-fluorophenyl)methyl]-3,3-diethylpiperazine (PubChem CID 114860293) has the molecular formula C15H22ClFN2
and a molecular weight of 284.81 g/mol. Its IUPAC name is 1-[(4-chloro-2-fluorophenyl)methyl]-3,3-diethylpiperazine.
Molecular Properties
| Compound Name | 1-[(4-chloro-2-fluorophenyl)methyl]-3,3-diethylpiperazine |
| PubChem CID | 114860293 |
| Molecular Formula | C15H22ClFN2 |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-[(4-chloro-2-fluorophenyl)methyl]-3,3-diethylpiperazine |
| SMILES | CCC1(CC)CN(Cc2ccc(Cl)cc2F)CCN1 |
| InChI | InChI=1S/C15H22ClFN2/c1-3-15(4-2)11-19(8-7-18-15)10-12-5-6-13(16)9-14(12)17/h5-6,9,18H,3-4,7-8,10-11H2,1-2H3 |
| InChIKey | SANGNNGNLXBFES-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(4-chloro-2-fluorophenyl)methyl]-3,3-diethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-chloro-2-fluorophenyl)methyl]-3,3-diethylpiperazine?
The IUPAC name of 1-[(4-chloro-2-fluorophenyl)methyl]-3,3-diethylpiperazine (CID 114860293) is 1-[(4-chloro-2-fluorophenyl)methyl]-3,3-diethylpiperazine.
What is the SMILES notation for 1-[(4-chloro-2-fluorophenyl)methyl]-3,3-diethylpiperazine?
The canonical SMILES for 1-[(4-chloro-2-fluorophenyl)methyl]-3,3-diethylpiperazine is CCC1(CC)CN(Cc2ccc(Cl)cc2F)CCN1.
What is the InChIKey of 1-[(4-chloro-2-fluorophenyl)methyl]-3,3-diethylpiperazine?
The InChIKey is SANGNNGNLXBFES-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22ClFN2/c1-3-15(4-2)11-19(8-7-18-15)10-12-5-6-13(16)9-14(12)17/h5-6,9,18H,3-4,7-8,10-11H2,1-2H3.
What are the key properties of 1-[(4-chloro-2-fluorophenyl)methyl]-3,3-diethylpiperazine?
1-[(4-chloro-2-fluorophenyl)methyl]-3,3-diethylpiperazine has a molecular weight of 284.81 g/mol, XLogP of 3.44, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-chloro-2-fluorophenyl)methyl]-3,3-diethylpiperazine is sourced from PubChem (CID 114860293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).