C22H31NO3S — CID 11486083
4-methyl-N-[(2R,3R)-2-methyl-1-phenylmethoxyheptan-3-yl]benzenesulfonamide (PubChem CID 11486083) has the molecular formula C22H31NO3S and a molecular weight of 389.56 g/mol. Its IUPAC name is 4-methyl-N-[(2R,3R)-2-methyl-1-phenylmethoxyheptan-3-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(2R,3R)-2-methyl-1-phenylmethoxyheptan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 11486083 |
| Molecular Formula | C22H31NO3S |
| Molecular Weight | 389.56 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 4-methyl-N-[(2R,3R)-2-methyl-1-phenylmethoxyheptan-3-yl]benzenesulfonamide |
| SMILES | CCCC[C@@H](NS(=O)(=O)c1ccc(C)cc1)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C22H31NO3S/c1-4-5-11-22(19(3)16-26-17-20-9-7-6-8-10-20)23-27(24,25)21-14-12-18(2)13-15-21/h6-10,12-15,19,22-23H,4-5,11,16-17H2,1-3H3/t19-,22+/m0/s1 |
| InChIKey | QGYSZBFKVXJWQS-SIKLNZKXSA-N |
| XLogP | 4.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |