C16H27ClN2O2 — CID 114861459
2-(2-aminobutyl)-5-chloro-N,N-bis(2-methoxyethyl)aniline (PubChem CID 114861459) has the molecular formula C16H27ClN2O2 and a molecular weight of 314.86 g/mol. Its IUPAC name is 2-(2-aminobutyl)-5-chloro-N,N-bis(2-methoxyethyl)aniline.
| Compound Name | 2-(2-aminobutyl)-5-chloro-N,N-bis(2-methoxyethyl)aniline |
|---|---|
| PubChem CID | 114861459 |
| Molecular Formula | C16H27ClN2O2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 2-(2-aminobutyl)-5-chloro-N,N-bis(2-methoxyethyl)aniline |
| SMILES | CCC(N)Cc1ccc(Cl)cc1N(CCOC)CCOC |
| InChI | InChI=1S/C16H27ClN2O2/c1-4-15(18)11-13-5-6-14(17)12-16(13)19(7-9-20-2)8-10-21-3/h5-6,12,15H,4,7-11,18H2,1-3H3 |
| InChIKey | HZCLBNGGTSXUHN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |