C18H28O8 — CID 11486234
(2R,3R)-2,3-diacetyloxy-4-(5-methyl-2-propan-2-ylcyclohexyl)oxy-4-oxobutanoic acid (PubChem CID 11486234) has the molecular formula C18H28O8 and a molecular weight of 372.41 g/mol. Its IUPAC name is (2R,3R)-2,3-diacetyloxy-4-(5-methyl-2-propan-2-ylcyclohexyl)oxy-4-oxobutanoic acid.
| Compound Name | (2R,3R)-2,3-diacetyloxy-4-(5-methyl-2-propan-2-ylcyclohexyl)oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 11486234 |
| Molecular Formula | C18H28O8 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (2R,3R)-2,3-diacetyloxy-4-(5-methyl-2-propan-2-ylcyclohexyl)oxy-4-oxobutanoic acid |
| SMILES | CC(=O)O[C@@H](C(=O)O)[C@@H](OC(C)=O)C(=O)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C18H28O8/c1-9(2)13-7-6-10(3)8-14(13)26-18(23)16(25-12(5)20)15(17(21)22)24-11(4)19/h9-10,13-16H,6-8H2,1-5H3,(H,21,22)/t10?,13?,14?,15-,16-/m1/s1 |
| InChIKey | XDFKBRJQCYLHFI-CWWYUQMFSA-N |
| XLogP | 1.94 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|