C18H27ClFN — CID 114862740
N-[[2-[(4-chloro-2-fluorophenyl)methyl]-4-ethylcyclohexyl]methyl]ethanamine (PubChem CID 114862740) has the molecular formula C18H27ClFN and a molecular weight of 311.87 g/mol. Its IUPAC name is N-[[2-[(4-chloro-2-fluorophenyl)methyl]-4-ethylcyclohexyl]methyl]ethanamine.
| Compound Name | N-[[2-[(4-chloro-2-fluorophenyl)methyl]-4-ethylcyclohexyl]methyl]ethanamine |
|---|---|
| PubChem CID | 114862740 |
| Molecular Formula | C18H27ClFN |
| Molecular Weight | 311.87 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | N-[[2-[(4-chloro-2-fluorophenyl)methyl]-4-ethylcyclohexyl]methyl]ethanamine |
| SMILES | CCNCC1CCC(CC)CC1Cc1ccc(Cl)cc1F |
| InChI | InChI=1S/C18H27ClFN/c1-3-13-5-6-15(12-21-4-2)16(9-13)10-14-7-8-17(19)11-18(14)20/h7-8,11,13,15-16,21H,3-6,9-10,12H2,1-2H3 |
| InChIKey | JPIVXTJZIAELRV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.87 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |