C16H18Cl2N2S — CID 114864921
N-[[5-chloro-2-[(3-chloro-2-pyridinyl)sulfanyl]phenyl]methyl]-2-methylpropan-1-amine (PubChem CID 114864921) has the molecular formula C16H18Cl2N2S and a molecular weight of 341.31 g/mol. Its IUPAC name is N-[[5-chloro-2-[(3-chloro-2-pyridinyl)sulfanyl]phenyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[5-chloro-2-[(3-chloro-2-pyridinyl)sulfanyl]phenyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 114864921 |
| Molecular Formula | C16H18Cl2N2S |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | N-[[5-chloro-2-[(3-chloro-2-pyridinyl)sulfanyl]phenyl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1cc(Cl)ccc1Sc1ncccc1Cl |
| InChI | InChI=1S/C16H18Cl2N2S/c1-11(2)9-19-10-12-8-13(17)5-6-15(12)21-16-14(18)4-3-7-20-16/h3-8,11,19H,9-10H2,1-2H3 |
| InChIKey | KHGUCPUPDQQUTF-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |