C11H14ClNOS — CID 114865010
1-[5-chloro-2-(oxetan-3-ylsulfanyl)phenyl]-N-methylmethanamine (PubChem CID 114865010) has the molecular formula C11H14ClNOS and a molecular weight of 243.76 g/mol. Its IUPAC name is 1-[5-chloro-2-(oxetan-3-ylsulfanyl)phenyl]-N-methylmethanamine.
| Compound Name | 1-[5-chloro-2-(oxetan-3-ylsulfanyl)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 114865010 |
| Molecular Formula | C11H14ClNOS |
| Molecular Weight | 243.76 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 1-[5-chloro-2-(oxetan-3-ylsulfanyl)phenyl]-N-methylmethanamine |
| SMILES | CNCc1cc(Cl)ccc1SC1COC1 |
| InChI | InChI=1S/C11H14ClNOS/c1-13-5-8-4-9(12)2-3-11(8)15-10-6-14-7-10/h2-4,10,13H,5-7H2,1H3 |
| InChIKey | WYMMSOZAQUDTEU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.76 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |