C20H23N9O — CID 11486549
5-[4-[(2,4-dimethyl-3-pyridinyl)methyl]piperazin-1-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 11486549) has the molecular formula C20H23N9O and a molecular weight of 405.47 g/mol. Its IUPAC name is 5-[4-[(2,4-dimethyl-3-pyridinyl)methyl]piperazin-1-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 5-[4-[(2,4-dimethyl-3-pyridinyl)methyl]piperazin-1-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 11486549 |
| Molecular Formula | C20H23N9O |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 5-[4-[(2,4-dimethyl-3-pyridinyl)methyl]piperazin-1-yl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | Cc1ccnc(C)c1CN1CCN(c2nc(N)n3nc(-c4ccco4)nc3n2)CC1 |
| InChI | InChI=1S/C20H23N9O/c1-13-5-6-22-14(2)15(13)12-27-7-9-28(10-8-27)19-24-18(21)29-20(25-19)23-17(26-29)16-4-3-11-30-16/h3-6,11H,7-10,12H2,1-2H3,(H2,21,23,24,25,26) |
| InChIKey | BLFIZZXKTHAQAK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |