C23H40O4Si — CID 11486646
[(1R,4S,5R)-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-4-(2-oxoethyl)cyclopent-2-en-1-yl] acetate (PubChem CID 11486646) has the molecular formula C23H40O4Si and a molecular weight of 408.66 g/mol. Its IUPAC name is [(1R,4S,5R)-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-4-(2-oxoethyl)cyclopent-2-en-1-yl] acetate.
| Compound Name | [(1R,4S,5R)-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-4-(2-oxoethyl)cyclopent-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 11486646 |
| Molecular Formula | C23H40O4Si |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | [(1R,4S,5R)-5-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-4-(2-oxoethyl)cyclopent-2-en-1-yl] acetate |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](CC=O)C=C[C@H]1OC(C)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H40O4Si/c1-8-9-10-11-20(27-28(6,7)23(3,4)5)13-14-21-19(16-17-24)12-15-22(21)26-18(2)25/h12-15,17,19-22H,8-11,16H2,1-7H3/b14-13+/t19-,20+,21-,22-/m1/s1 |
| InChIKey | SZRCLQYLKSSSJC-COWZSFORSA-N |
| XLogP | 5.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|