C18H35NO2 — CID 114867007
3-[1-(2,6-dimethylheptan-4-yl)piperidin-3-yl]butanoic acid (PubChem CID 114867007) has the molecular formula C18H35NO2 and a molecular weight of 297.48 g/mol. Its IUPAC name is 3-[1-(2,6-dimethylheptan-4-yl)piperidin-3-yl]butanoic acid.
| Compound Name | 3-[1-(2,6-dimethylheptan-4-yl)piperidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 114867007 |
| Molecular Formula | C18H35NO2 |
| Molecular Weight | 297.48 g/mol |
| Exact Mass | 297.27 |
| IUPAC Name | 3-[1-(2,6-dimethylheptan-4-yl)piperidin-3-yl]butanoic acid |
| SMILES | CC(C)CC(CC(C)C)N1CCCC(C(C)CC(=O)O)C1 |
| InChI | InChI=1S/C18H35NO2/c1-13(2)9-17(10-14(3)4)19-8-6-7-16(12-19)15(5)11-18(20)21/h13-17H,6-12H2,1-5H3,(H,20,21) |
| InChIKey | WRDOUZDSWRWQMA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |