C14H25NO2 — CID 114867239
3-methyl-4,4-bis(2-methylpropyl)piperidine-2,6-dione (PubChem CID 114867239) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 3-methyl-4,4-bis(2-methylpropyl)piperidine-2,6-dione.
| Compound Name | 3-methyl-4,4-bis(2-methylpropyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 114867239 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 3-methyl-4,4-bis(2-methylpropyl)piperidine-2,6-dione |
| SMILES | CC(C)CC1(CC(C)C)CC(=O)NC(=O)C1C |
| InChI | InChI=1S/C14H25NO2/c1-9(2)6-14(7-10(3)4)8-12(16)15-13(17)11(14)5/h9-11H,6-8H2,1-5H3,(H,15,16,17) |
| InChIKey | NYFQWUQWJQGTQB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|