About 3-(4-chlorophenyl)-4,4-bis(2-methylpropyl)piperidine
3-(4-chlorophenyl)-4,4-bis(2-methylpropyl)piperidine (PubChem CID 114867310) has the molecular formula C19H30ClN
and a molecular weight of 307.91 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4,4-bis(2-methylpropyl)piperidine.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-4,4-bis(2-methylpropyl)piperidine |
| PubChem CID | 114867310 |
| Molecular Formula | C19H30ClN |
| Molecular Weight | 307.91 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 3-(4-chlorophenyl)-4,4-bis(2-methylpropyl)piperidine |
| SMILES | CC(C)CC1(CC(C)C)CCNCC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H30ClN/c1-14(2)11-19(12-15(3)4)9-10-21-13-18(19)16-5-7-17(20)8-6-16/h5-8,14-15,18,21H,9-13H2,1-4H3 |
| InChIKey | ZDMOWFMTTJWEHN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.91 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(4-chlorophenyl)-4,4-bis(2-methylpropyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-4,4-bis(2-methylpropyl)piperidine?
The IUPAC name of 3-(4-chlorophenyl)-4,4-bis(2-methylpropyl)piperidine (CID 114867310) is 3-(4-chlorophenyl)-4,4-bis(2-methylpropyl)piperidine.
What is the SMILES notation for 3-(4-chlorophenyl)-4,4-bis(2-methylpropyl)piperidine?
The canonical SMILES for 3-(4-chlorophenyl)-4,4-bis(2-methylpropyl)piperidine is CC(C)CC1(CC(C)C)CCNCC1c1ccc(Cl)cc1.
What is the InChIKey of 3-(4-chlorophenyl)-4,4-bis(2-methylpropyl)piperidine?
The InChIKey is ZDMOWFMTTJWEHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30ClN/c1-14(2)11-19(12-15(3)4)9-10-21-13-18(19)16-5-7-17(20)8-6-16/h5-8,14-15,18,21H,9-13H2,1-4H3.
What are the key properties of 3-(4-chlorophenyl)-4,4-bis(2-methylpropyl)piperidine?
3-(4-chlorophenyl)-4,4-bis(2-methylpropyl)piperidine has a molecular weight of 307.91 g/mol, XLogP of 5.50, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-4,4-bis(2-methylpropyl)piperidine is sourced from PubChem (CID 114867310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).