About 2-N-cyclopropyl-2-N-(cyclopropylmethyl)-4-methyl-2-(2-methylpropyl)pentane-1,2-diamine
2-N-cyclopropyl-2-N-(cyclopropylmethyl)-4-methyl-2-(2-methylpropyl)pentane-1,2-diamine (PubChem CID 114867730) has the molecular formula C17H34N2
and a molecular weight of 266.47 g/mol. Its IUPAC name is 2-N-cyclopropyl-2-N-(cyclopropylmethyl)-4-methyl-2-(2-methylpropyl)pentane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-cyclopropyl-2-N-(cyclopropylmethyl)-4-methyl-2-(2-methylpropyl)pentane-1,2-diamine |
| PubChem CID | 114867730 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | 2-N-cyclopropyl-2-N-(cyclopropylmethyl)-4-methyl-2-(2-methylpropyl)pentane-1,2-diamine |
| SMILES | CC(C)CC(CN)(CC(C)C)N(CC1CC1)C1CC1 |
| InChI | InChI=1S/C17H34N2/c1-13(2)9-17(12-18,10-14(3)4)19(16-7-8-16)11-15-5-6-15/h13-16H,5-12,18H2,1-4H3 |
| InChIKey | GWCNPHFDFKOIBK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-N-cyclopropyl-2-N-(cyclopropylmethyl)-4-methyl-2-(2-methylpropyl)pentane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-cyclopropyl-2-N-(cyclopropylmethyl)-4-methyl-2-(2-methylpropyl)pentane-1,2-diamine?
The IUPAC name of 2-N-cyclopropyl-2-N-(cyclopropylmethyl)-4-methyl-2-(2-methylpropyl)pentane-1,2-diamine (CID 114867730) is 2-N-cyclopropyl-2-N-(cyclopropylmethyl)-4-methyl-2-(2-methylpropyl)pentane-1,2-diamine.
What is the SMILES notation for 2-N-cyclopropyl-2-N-(cyclopropylmethyl)-4-methyl-2-(2-methylpropyl)pentane-1,2-diamine?
The canonical SMILES for 2-N-cyclopropyl-2-N-(cyclopropylmethyl)-4-methyl-2-(2-methylpropyl)pentane-1,2-diamine is CC(C)CC(CN)(CC(C)C)N(CC1CC1)C1CC1.
What is the InChIKey of 2-N-cyclopropyl-2-N-(cyclopropylmethyl)-4-methyl-2-(2-methylpropyl)pentane-1,2-diamine?
The InChIKey is GWCNPHFDFKOIBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34N2/c1-13(2)9-17(12-18,10-14(3)4)19(16-7-8-16)11-15-5-6-15/h13-16H,5-12,18H2,1-4H3.
What are the key properties of 2-N-cyclopropyl-2-N-(cyclopropylmethyl)-4-methyl-2-(2-methylpropyl)pentane-1,2-diamine?
2-N-cyclopropyl-2-N-(cyclopropylmethyl)-4-methyl-2-(2-methylpropyl)pentane-1,2-diamine has a molecular weight of 266.47 g/mol, XLogP of 3.65, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-cyclopropyl-2-N-(cyclopropylmethyl)-4-methyl-2-(2-methylpropyl)pentane-1,2-diamine is sourced from PubChem (CID 114867730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).