C13H24N2S — CID 114868540
2,6-dimethyl-4-(4-methyl-1,3-thiazol-2-yl)heptan-4-amine (PubChem CID 114868540) has the molecular formula C13H24N2S and a molecular weight of 240.42 g/mol. Its IUPAC name is 2,6-dimethyl-4-(4-methyl-1,3-thiazol-2-yl)heptan-4-amine.
| Compound Name | 2,6-dimethyl-4-(4-methyl-1,3-thiazol-2-yl)heptan-4-amine |
|---|---|
| PubChem CID | 114868540 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 2,6-dimethyl-4-(4-methyl-1,3-thiazol-2-yl)heptan-4-amine |
| SMILES | Cc1csc(C(N)(CC(C)C)CC(C)C)n1 |
| InChI | InChI=1S/C13H24N2S/c1-9(2)6-13(14,7-10(3)4)12-15-11(5)8-16-12/h8-10H,6-7,14H2,1-5H3 |
| InChIKey | SYNGFYSTEQQYSF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |