C12H25N — CID 114868694
[2,2-bis(2-methylpropyl)cyclopropyl]methanamine (PubChem CID 114868694) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is [2,2-bis(2-methylpropyl)cyclopropyl]methanamine.
| Compound Name | [2,2-bis(2-methylpropyl)cyclopropyl]methanamine |
|---|---|
| PubChem CID | 114868694 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | [2,2-bis(2-methylpropyl)cyclopropyl]methanamine |
| SMILES | CC(C)CC1(CC(C)C)CC1CN |
| InChI | InChI=1S/C12H25N/c1-9(2)5-12(6-10(3)4)7-11(12)8-13/h9-11H,5-8,13H2,1-4H3 |
| InChIKey | LGCFRTXOLWIUJW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |