C17H24ClN3O5S — CID 1148688
ethyl 4-[2-(3-chloro-4-methyl-N-methylsulfonylanilino)acetyl]piperazine-1-carboxylate (PubChem CID 1148688) has the molecular formula C17H24ClN3O5S and a molecular weight of 417.92 g/mol. Its IUPAC name is ethyl 4-[2-(3-chloro-4-methyl-N-methylsulfonylanilino)acetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(3-chloro-4-methyl-N-methylsulfonylanilino)acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 1148688 |
| Molecular Formula | C17H24ClN3O5S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | ethyl 4-[2-(3-chloro-4-methyl-N-methylsulfonylanilino)acetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CN(c2ccc(C)c(Cl)c2)S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C17H24ClN3O5S/c1-4-26-17(23)20-9-7-19(8-10-20)16(22)12-21(27(3,24)25)14-6-5-13(2)15(18)11-14/h5-6,11H,4,7-10,12H2,1-3H3 |
| InChIKey | KYRDMLXUINTUIW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |