C15H21BrN2 — CID 114869144
N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-5-bromo-4-methylpyridin-2-amine (PubChem CID 114869144) has the molecular formula C15H21BrN2 and a molecular weight of 309.25 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-5-bromo-4-methylpyridin-2-amine.
| Compound Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-5-bromo-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 114869144 |
| Molecular Formula | C15H21BrN2 |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-5-bromo-4-methylpyridin-2-amine |
| SMILES | Cc1cc(NC(C)C2CC3CCC2C3)ncc1Br |
| InChI | InChI=1S/C15H21BrN2/c1-9-5-15(17-8-14(9)16)18-10(2)13-7-11-3-4-12(13)6-11/h5,8,10-13H,3-4,6-7H2,1-2H3,(H,17,18) |
| InChIKey | VNZQYTAJXJFFCG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |