About 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-phenyl-1H-indole-6-carbonitrile
3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-phenyl-1H-indole-6-carbonitrile (PubChem CID 11486935) has the molecular formula C29H29N3
and a molecular weight of 419.57 g/mol. Its IUPAC name is 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-phenyl-1H-indole-6-carbonitrile.
Molecular Properties
| Compound Name | 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-phenyl-1H-indole-6-carbonitrile |
| PubChem CID | 11486935 |
| Molecular Formula | C29H29N3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-phenyl-1H-indole-6-carbonitrile |
| SMILES | Cc1cccc(C)c1C1CCN(Cc2c(-c3ccccc3)[nH]c3cc(C#N)ccc23)CC1 |
| InChI | InChI=1S/C29H29N3/c1-20-7-6-8-21(2)28(20)23-13-15-32(16-14-23)19-26-25-12-11-22(18-30)17-27(25)31-29(26)24-9-4-3-5-10-24/h3-12,17,23,31H,13-16,19H2,1-2H3 |
| InChIKey | KZTPVBBQRXZNHA-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 42.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-phenyl-1H-indole-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-phenyl-1H-indole-6-carbonitrile?
The IUPAC name of 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-phenyl-1H-indole-6-carbonitrile (CID 11486935) is 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-phenyl-1H-indole-6-carbonitrile.
What is the SMILES notation for 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-phenyl-1H-indole-6-carbonitrile?
The canonical SMILES for 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-phenyl-1H-indole-6-carbonitrile is Cc1cccc(C)c1C1CCN(Cc2c(-c3ccccc3)[nH]c3cc(C#N)ccc23)CC1.
What is the InChIKey of 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-phenyl-1H-indole-6-carbonitrile?
The InChIKey is KZTPVBBQRXZNHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H29N3/c1-20-7-6-8-21(2)28(20)23-13-15-32(16-14-23)19-26-25-12-11-22(18-30)17-27(25)31-29(26)24-9-4-3-5-10-24/h3-12,17,23,31H,13-16,19H2,1-2H3.
What are the key properties of 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-phenyl-1H-indole-6-carbonitrile?
3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-phenyl-1H-indole-6-carbonitrile has a molecular weight of 419.57 g/mol, XLogP of 6.70, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(2,6-dimethylphenyl)piperidin-1-yl]methyl]-2-phenyl-1H-indole-6-carbonitrile is sourced from PubChem (CID 11486935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).