About N-phenylaniline
N-phenylaniline (PubChem CID 11487) has the molecular formula C12H11N
and a molecular weight of 169.23 g/mol. Its IUPAC name is N-phenylaniline.
Molecular Properties
| Compound Name | N-phenylaniline |
| PubChem CID | 11487 |
| Molecular Formula | C12H11N |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | N-phenylaniline |
| SMILES | c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10,13H |
| InChIKey | DMBHHRLKUKUOEG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenylaniline?
The IUPAC name of N-phenylaniline (CID 11487) is N-phenylaniline.
What is the SMILES notation for N-phenylaniline?
The canonical SMILES for N-phenylaniline is c1ccc(Nc2ccccc2)cc1.
What is the InChIKey of N-phenylaniline?
The InChIKey is DMBHHRLKUKUOEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10,13H.
What are the key properties of N-phenylaniline?
N-phenylaniline has a molecular weight of 169.23 g/mol, XLogP of 3.43, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylaniline is sourced from PubChem (CID 11487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).