C14H21BrN2 — CID 114870455
1-(5-bromo-4-methyl-2-pyridinyl)-4,4-dimethylazepane (PubChem CID 114870455) has the molecular formula C14H21BrN2 and a molecular weight of 297.24 g/mol. Its IUPAC name is 1-(5-bromo-4-methyl-2-pyridinyl)-4,4-dimethylazepane.
| Compound Name | 1-(5-bromo-4-methyl-2-pyridinyl)-4,4-dimethylazepane |
|---|---|
| PubChem CID | 114870455 |
| Molecular Formula | C14H21BrN2 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 1-(5-bromo-4-methyl-2-pyridinyl)-4,4-dimethylazepane |
| SMILES | Cc1cc(N2CCCC(C)(C)CC2)ncc1Br |
| InChI | InChI=1S/C14H21BrN2/c1-11-9-13(16-10-12(11)15)17-7-4-5-14(2,3)6-8-17/h9-10H,4-8H2,1-3H3 |
| InChIKey | WMUXDMCUEIBCRZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |