About 5-bromo-2-(4,4-dimethylcyclohexyl)oxy-4-methylpyridine
5-bromo-2-(4,4-dimethylcyclohexyl)oxy-4-methylpyridine (PubChem CID 114870816) has the molecular formula C14H20BrNO
and a molecular weight of 298.22 g/mol. Its IUPAC name is 5-bromo-2-(4,4-dimethylcyclohexyl)oxy-4-methylpyridine.
Molecular Properties
| Compound Name | 5-bromo-2-(4,4-dimethylcyclohexyl)oxy-4-methylpyridine |
| PubChem CID | 114870816 |
| Molecular Formula | C14H20BrNO |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 5-bromo-2-(4,4-dimethylcyclohexyl)oxy-4-methylpyridine |
| SMILES | Cc1cc(OC2CCC(C)(C)CC2)ncc1Br |
| InChI | InChI=1S/C14H20BrNO/c1-10-8-13(16-9-12(10)15)17-11-4-6-14(2,3)7-5-11/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | FAAGQWXOZWRGTL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-2-(4,4-dimethylcyclohexyl)oxy-4-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(4,4-dimethylcyclohexyl)oxy-4-methylpyridine?
The IUPAC name of 5-bromo-2-(4,4-dimethylcyclohexyl)oxy-4-methylpyridine (CID 114870816) is 5-bromo-2-(4,4-dimethylcyclohexyl)oxy-4-methylpyridine.
What is the SMILES notation for 5-bromo-2-(4,4-dimethylcyclohexyl)oxy-4-methylpyridine?
The canonical SMILES for 5-bromo-2-(4,4-dimethylcyclohexyl)oxy-4-methylpyridine is Cc1cc(OC2CCC(C)(C)CC2)ncc1Br.
What is the InChIKey of 5-bromo-2-(4,4-dimethylcyclohexyl)oxy-4-methylpyridine?
The InChIKey is FAAGQWXOZWRGTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20BrNO/c1-10-8-13(16-9-12(10)15)17-11-4-6-14(2,3)7-5-11/h8-9,11H,4-7H2,1-3H3.
What are the key properties of 5-bromo-2-(4,4-dimethylcyclohexyl)oxy-4-methylpyridine?
5-bromo-2-(4,4-dimethylcyclohexyl)oxy-4-methylpyridine has a molecular weight of 298.22 g/mol, XLogP of 4.50, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(4,4-dimethylcyclohexyl)oxy-4-methylpyridine is sourced from PubChem (CID 114870816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).