C17H19F2N — CID 114870966
1-(3-fluorophenyl)-N-[2-(4-fluorophenyl)ethyl]propan-1-amine (PubChem CID 114870966) has the molecular formula C17H19F2N and a molecular weight of 275.34 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-[2-(4-fluorophenyl)ethyl]propan-1-amine.
| Compound Name | 1-(3-fluorophenyl)-N-[2-(4-fluorophenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 114870966 |
| Molecular Formula | C17H19F2N |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 1-(3-fluorophenyl)-N-[2-(4-fluorophenyl)ethyl]propan-1-amine |
| SMILES | CCC(NCCc1ccc(F)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C17H19F2N/c1-2-17(14-4-3-5-16(19)12-14)20-11-10-13-6-8-15(18)9-7-13/h3-9,12,17,20H,2,10-11H2,1H3 |
| InChIKey | LRRYPDWUSHJIEO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |