C22H29N3O4Si — CID 11487162
(2S,3R,4S,5R)-5-(azidomethyl)-4-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 11487162) has the molecular formula C22H29N3O4Si and a molecular weight of 427.58 g/mol. Its IUPAC name is (2S,3R,4S,5R)-5-(azidomethyl)-4-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2S,3R,4S,5R)-5-(azidomethyl)-4-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 11487162 |
| Molecular Formula | C22H29N3O4Si |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | (2S,3R,4S,5R)-5-(azidomethyl)-4-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | CC(C)(C)[Si](O[C@H]1[C@H](O)[C@H](CO)O[C@@H]1CN=[N+]=[N-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H29N3O4Si/c1-22(2,3)30(16-10-6-4-7-11-16,17-12-8-5-9-13-17)29-21-18(14-24-25-23)28-19(15-26)20(21)27/h4-13,18-21,26-27H,14-15H2,1-3H3/t18-,19+,20-,21-/m1/s1 |
| InChIKey | XDRIQFRSWAYKOZ-PLACYPQZSA-N |
| XLogP | 2.36 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|