C15H20FNO — CID 114872207
7-(3-fluorophenyl)-8-methyl-6-oxa-9-azaspiro[4.5]decane (PubChem CID 114872207) has the molecular formula C15H20FNO and a molecular weight of 249.33 g/mol. Its IUPAC name is 7-(3-fluorophenyl)-8-methyl-6-oxa-9-azaspiro[4.5]decane.
| Compound Name | 7-(3-fluorophenyl)-8-methyl-6-oxa-9-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 114872207 |
| Molecular Formula | C15H20FNO |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 7-(3-fluorophenyl)-8-methyl-6-oxa-9-azaspiro[4.5]decane |
| SMILES | CC1NCC2(CCCC2)OC1c1cccc(F)c1 |
| InChI | InChI=1S/C15H20FNO/c1-11-14(12-5-4-6-13(16)9-12)18-15(10-17-11)7-2-3-8-15/h4-6,9,11,14,17H,2-3,7-8,10H2,1H3 |
| InChIKey | CYWUQKGFITZPKH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |