C15H19FN4 — CID 114872947
1-[5-(3-fluorophenyl)-4-methyl-1H-pyrazol-3-yl]piperidin-3-amine (PubChem CID 114872947) has the molecular formula C15H19FN4 and a molecular weight of 274.34 g/mol. Its IUPAC name is 1-[5-(3-fluorophenyl)-4-methyl-1H-pyrazol-3-yl]piperidin-3-amine.
| Compound Name | 1-[5-(3-fluorophenyl)-4-methyl-1H-pyrazol-3-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 114872947 |
| Molecular Formula | C15H19FN4 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 1-[5-(3-fluorophenyl)-4-methyl-1H-pyrazol-3-yl]piperidin-3-amine |
| SMILES | Cc1c(N2CCCC(N)C2)n[nH]c1-c1cccc(F)c1 |
| InChI | InChI=1S/C15H19FN4/c1-10-14(11-4-2-5-12(16)8-11)18-19-15(10)20-7-3-6-13(17)9-20/h2,4-5,8,13H,3,6-7,9,17H2,1H3,(H,18,19) |
| InChIKey | KQFRYTXFIIROKO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |