C12H23NO3 — CID 114873856
5-(3-methylpentanoylamino)hexanoic acid (PubChem CID 114873856) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is 5-(3-methylpentanoylamino)hexanoic acid.
| Compound Name | 5-(3-methylpentanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 114873856 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 5-(3-methylpentanoylamino)hexanoic acid |
| SMILES | CCC(C)CC(=O)NC(C)CCCC(=O)O |
| InChI | InChI=1S/C12H23NO3/c1-4-9(2)8-11(14)13-10(3)6-5-7-12(15)16/h9-10H,4-8H2,1-3H3,(H,13,14)(H,15,16) |
| InChIKey | ZBYNUVBIWOAUNK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |