C19H30ClIO — CID 11487412
(3S,10S,13S,16R)-17-chloro-16-iodo-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 11487412) has the molecular formula C19H30ClIO and a molecular weight of 436.81 g/mol. Its IUPAC name is (3S,10S,13S,16R)-17-chloro-16-iodo-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,10S,13S,16R)-17-chloro-16-iodo-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 11487412 |
| Molecular Formula | C19H30ClIO |
| Molecular Weight | 436.81 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | (3S,10S,13S,16R)-17-chloro-16-iodo-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@H](O)CC1CCC1C2CC[C@@]2(C)C1C[C@@H](I)C2Cl |
| InChI | InChI=1S/C19H30ClIO/c1-18-7-5-12(22)9-11(18)3-4-13-14(18)6-8-19(2)15(13)10-16(21)17(19)20/h11-17,22H,3-10H2,1-2H3/t11?,12-,13?,14?,15?,16+,17?,18-,19-/m0/s1 |
| InChIKey | BKTJYZAZFLZZKJ-KZIHOANASA-N |
| XLogP | 5.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.81 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|