C25H25F3NOP — CID 11487569
(E)-N-bis(3,5-dimethylphenyl)phosphoryl-1-[4-(trifluoromethyl)phenyl]ethanimine (PubChem CID 11487569) has the molecular formula C25H25F3NOP and a molecular weight of 443.45 g/mol. Its IUPAC name is (E)-N-bis(3,5-dimethylphenyl)phosphoryl-1-[4-(trifluoromethyl)phenyl]ethanimine.
| Compound Name | (E)-N-bis(3,5-dimethylphenyl)phosphoryl-1-[4-(trifluoromethyl)phenyl]ethanimine |
|---|---|
| PubChem CID | 11487569 |
| Molecular Formula | C25H25F3NOP |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | (E)-N-bis(3,5-dimethylphenyl)phosphoryl-1-[4-(trifluoromethyl)phenyl]ethanimine |
| SMILES | C/C(=N\P(=O)(c1cc(C)cc(C)c1)c1cc(C)cc(C)c1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H25F3NOP/c1-16-10-17(2)13-23(12-16)31(30,24-14-18(3)11-19(4)15-24)29-20(5)21-6-8-22(9-7-21)25(26,27)28/h6-15H,1-5H3/b29-20+ |
| InChIKey | JQMIIMBSNITMLT-ZTKZIYFRSA-N |
| XLogP | 6.68 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|