C28H30O3S — CID 11487661
(1S,13R)-13-phenylsulfanyl-12-oxatetracyclo[11.10.0.02,11.04,9]tricosa-2(11),4,6,8-tetraene-3,10-dione (PubChem CID 11487661) has the molecular formula C28H30O3S and a molecular weight of 446.61 g/mol. Its IUPAC name is (1S,13R)-13-phenylsulfanyl-12-oxatetracyclo[11.10.0.02,11.04,9]tricosa-2(11),4,6,8-tetraene-3,10-dione.
| Compound Name | (1S,13R)-13-phenylsulfanyl-12-oxatetracyclo[11.10.0.02,11.04,9]tricosa-2(11),4,6,8-tetraene-3,10-dione |
|---|---|
| PubChem CID | 11487661 |
| Molecular Formula | C28H30O3S |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | (1S,13R)-13-phenylsulfanyl-12-oxatetracyclo[11.10.0.02,11.04,9]tricosa-2(11),4,6,8-tetraene-3,10-dione |
| SMILES | O=C1C2=C(C(=O)c3ccccc31)[C@@H]1CCCCCCCCCC[C@]1(Sc1ccccc1)O2 |
| InChI | InChI=1S/C28H30O3S/c29-25-21-16-11-12-17-22(21)26(30)27-24(25)23-18-10-5-3-1-2-4-6-13-19-28(23,31-27)32-20-14-8-7-9-15-20/h7-9,11-12,14-17,23H,1-6,10,13,18-19H2/t23-,28+/m0/s1 |
| InChIKey | AIVXJOOXGVZGRT-NEKDWFFYSA-N |
| XLogP | 7.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|