C12H15BrN4 — CID 114877972
(4-bromo-1-ethylpyrazol-5-yl)-(4-methyl-3-pyridinyl)methanamine (PubChem CID 114877972) has the molecular formula C12H15BrN4 and a molecular weight of 295.18 g/mol. Its IUPAC name is (4-bromo-1-ethylpyrazol-5-yl)-(4-methyl-3-pyridinyl)methanamine.
| Compound Name | (4-bromo-1-ethylpyrazol-5-yl)-(4-methyl-3-pyridinyl)methanamine |
|---|---|
| PubChem CID | 114877972 |
| Molecular Formula | C12H15BrN4 |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | (4-bromo-1-ethylpyrazol-5-yl)-(4-methyl-3-pyridinyl)methanamine |
| SMILES | CCn1ncc(Br)c1C(N)c1cnccc1C |
| InChI | InChI=1S/C12H15BrN4/c1-3-17-12(10(13)7-16-17)11(14)9-6-15-5-4-8(9)2/h4-7,11H,3,14H2,1-2H3 |
| InChIKey | WGYUSBMBPAWANC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |